C18H16N4O4S — CID 126707742
N-(1,1-dioxothiolan-3-yl)-3-(5-nitrosoindazol-1-yl)benzamide (PubChem CID 126707742) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(5-nitrosoindazol-1-yl)benzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(5-nitrosoindazol-1-yl)benzamide |
|---|---|
| PubChem CID | 126707742 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(5-nitrosoindazol-1-yl)benzamide |
| SMILES | O=Nc1ccc2c(cnn2-c2cccc(C(=O)NC3CCS(=O)(=O)C3)c2)c1 |
| InChI | InChI=1S/C18H16N4O4S/c23-18(20-15-6-7-27(25,26)11-15)12-2-1-3-16(9-12)22-17-5-4-14(21-24)8-13(17)10-19-22/h1-5,8-10,15H,6-7,11H2,(H,20,23) |
| InChIKey | IEYBCDDQLWLBEC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |