C19H12ClF4N3O2 — CID 143816734
5-chloro-1-(2-fluorophenyl)-4-formyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide (PubChem CID 143816734) has the molecular formula C19H12ClF4N3O2 and a molecular weight of 425.77 g/mol. Its IUPAC name is 5-chloro-1-(2-fluorophenyl)-4-formyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide.
| Compound Name | 5-chloro-1-(2-fluorophenyl)-4-formyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 143816734 |
| Molecular Formula | C19H12ClF4N3O2 |
| Molecular Weight | 425.77 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 5-chloro-1-(2-fluorophenyl)-4-formyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide |
| SMILES | O=Cc1c(C(=O)NCc2ccc(C(F)(F)F)cc2)nn(-c2ccccc2F)c1Cl |
| InChI | InChI=1S/C19H12ClF4N3O2/c20-17-13(10-28)16(26-27(17)15-4-2-1-3-14(15)21)18(29)25-9-11-5-7-12(8-6-11)19(22,23)24/h1-8,10H,9H2,(H,25,29) |
| InChIKey | XCGFODDFCXKZSB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.77 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|