C9H18N2 — CID 143817204
(2S)-2-methyl-2,3-dihydropyridin-3-amine;propane (PubChem CID 143817204) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (2S)-2-methyl-2,3-dihydropyridin-3-amine;propane.
| Compound Name | (2S)-2-methyl-2,3-dihydropyridin-3-amine;propane |
|---|---|
| PubChem CID | 143817204 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (2S)-2-methyl-2,3-dihydropyridin-3-amine;propane |
| SMILES | CCC.C[C@@H]1N=CC=CC1N |
| InChI | InChI=1S/C6H10N2.C3H8/c1-5-6(7)3-2-4-8-5;1-3-2/h2-6H,7H2,1H3;3H2,1-2H3/t5-,6?;/m0./s1 |
| InChIKey | XIVOVSNUFWBURA-GNVLWMSISA-N |
| XLogP | 1.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |