C24H21FN2OS — CID 143817617
2-ethynyl-4-(4-fluorophenyl)-N-propan-2-yl-3-[(Z)-prop-1-enyl]-1,5-benzothiazepine-7-carboxamide (PubChem CID 143817617) has the molecular formula C24H21FN2OS and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-ethynyl-4-(4-fluorophenyl)-N-propan-2-yl-3-[(Z)-prop-1-enyl]-1,5-benzothiazepine-7-carboxamide.
| Compound Name | 2-ethynyl-4-(4-fluorophenyl)-N-propan-2-yl-3-[(Z)-prop-1-enyl]-1,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 143817617 |
| Molecular Formula | C24H21FN2OS |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-ethynyl-4-(4-fluorophenyl)-N-propan-2-yl-3-[(Z)-prop-1-enyl]-1,5-benzothiazepine-7-carboxamide |
| SMILES | C#CC1=C(/C=C\C)C(c2ccc(F)cc2)=Nc2cc(C(=O)NC(C)C)ccc2S1 |
| InChI | InChI=1S/C24H21FN2OS/c1-5-7-19-21(6-2)29-22-13-10-17(24(28)26-15(3)4)14-20(22)27-23(19)16-8-11-18(25)12-9-16/h2,5,7-15H,1,3-4H3,(H,26,28)/b7-5- |
| InChIKey | MBKXEZCNUIFWLA-ALCCZGGFSA-N |
| XLogP | 5.65 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|