C31H26FNOS — CID 143817654
(11E)-N-benzyl-12-(2-fluorophenyl)-N-methyl-2-thiatricyclo[11.4.0.03,8]heptadeca-1(17),3(8),4,6,11,13,15-heptaene-6-carboxamide (PubChem CID 143817654) has the molecular formula C31H26FNOS and a molecular weight of 479.62 g/mol. Its IUPAC name is (11E)-N-benzyl-12-(2-fluorophenyl)-N-methyl-2-thiatricyclo[11.4.0.03,8]heptadeca-1(17),3(8),4,6,11,13,15-heptaene-6-carboxamide.
| Compound Name | (11E)-N-benzyl-12-(2-fluorophenyl)-N-methyl-2-thiatricyclo[11.4.0.03,8]heptadeca-1(17),3(8),4,6,11,13,15-heptaene-6-carboxamide |
|---|---|
| PubChem CID | 143817654 |
| Molecular Formula | C31H26FNOS |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (11E)-N-benzyl-12-(2-fluorophenyl)-N-methyl-2-thiatricyclo[11.4.0.03,8]heptadeca-1(17),3(8),4,6,11,13,15-heptaene-6-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccc2c(c1)CC/C=C(\c1ccccc1F)c1ccccc1S2 |
| InChI | InChI=1S/C31H26FNOS/c1-33(21-22-10-3-2-4-11-22)31(34)24-18-19-29-23(20-24)12-9-15-25(26-13-5-7-16-28(26)32)27-14-6-8-17-30(27)35-29/h2-8,10-11,13-20H,9,12,21H2,1H3/b25-15+ |
| InChIKey | XSFINWLDHQKWPI-MFKUBSTISA-N |
| XLogP | 7.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |