C13H23F2N3O3S — CID 143818405
2-amino-1-(2-methylpyrrolidin-1-yl)ethanone;4,4-difluoro-2-formamido-3-methylbutanethioic S-acid (PubChem CID 143818405) has the molecular formula C13H23F2N3O3S and a molecular weight of 339.41 g/mol. Its IUPAC name is 2-amino-1-(2-methylpyrrolidin-1-yl)ethanone;4,4-difluoro-2-formamido-3-methylbutanethioic S-acid.
| Compound Name | 2-amino-1-(2-methylpyrrolidin-1-yl)ethanone;4,4-difluoro-2-formamido-3-methylbutanethioic S-acid |
|---|---|
| PubChem CID | 143818405 |
| Molecular Formula | C13H23F2N3O3S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-amino-1-(2-methylpyrrolidin-1-yl)ethanone;4,4-difluoro-2-formamido-3-methylbutanethioic S-acid |
| SMILES | CC(C(F)F)C(NC=O)C(=O)S.CC1CCCN1C(=O)CN |
| InChI | InChI=1S/C7H14N2O.C6H9F2NO2S/c1-6-3-2-4-9(6)7(10)5-8;1-3(5(7)8)4(6(11)12)9-2-10/h6H,2-5,8H2,1H3;2-5H,1H3,(H,9,10)(H,11,12) |
| InChIKey | XIBSBDFBOYIWRE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|