C17H31N3O3S — CID 143625603
2-amino-1-(2-methylpyrrolidin-1-yl)ethanone;(Z)-2-formamidonon-3-enethioic S-acid (PubChem CID 143625603) has the molecular formula C17H31N3O3S and a molecular weight of 357.52 g/mol. Its IUPAC name is 2-amino-1-(2-methylpyrrolidin-1-yl)ethanone;(Z)-2-formamidonon-3-enethioic S-acid.
| Compound Name | 2-amino-1-(2-methylpyrrolidin-1-yl)ethanone;(Z)-2-formamidonon-3-enethioic S-acid |
|---|---|
| PubChem CID | 143625603 |
| Molecular Formula | C17H31N3O3S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2-amino-1-(2-methylpyrrolidin-1-yl)ethanone;(Z)-2-formamidonon-3-enethioic S-acid |
| SMILES | CC1CCCN1C(=O)CN.CCCCC/C=C\C(NC=O)C(=O)S |
| InChI | InChI=1S/C10H17NO2S.C7H14N2O/c1-2-3-4-5-6-7-9(10(13)14)11-8-12;1-6-3-2-4-9(6)7(10)5-8/h6-9H,2-5H2,1H3,(H,11,12)(H,13,14);6H,2-5,8H2,1H3/b7-6-; |
| InChIKey | IEEIWECPUBSMMH-NAFXZHHSSA-N |
| XLogP | 1.65 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|