C21H36N2O4 — CID 143402766
ethyl formate;N-[(2S)-2-[(Z)-9-(2-methylpyrrolidin-1-yl)-9-oxonon-1-enyl]cyclopropyl]formamide (PubChem CID 143402766) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is ethyl formate;N-[(2S)-2-[(Z)-9-(2-methylpyrrolidin-1-yl)-9-oxonon-1-enyl]cyclopropyl]formamide.
| Compound Name | ethyl formate;N-[(2S)-2-[(Z)-9-(2-methylpyrrolidin-1-yl)-9-oxonon-1-enyl]cyclopropyl]formamide |
|---|---|
| PubChem CID | 143402766 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | ethyl formate;N-[(2S)-2-[(Z)-9-(2-methylpyrrolidin-1-yl)-9-oxonon-1-enyl]cyclopropyl]formamide |
| SMILES | CC1CCCN1C(=O)CCCCCC/C=C\[C@@H]1CC1NC=O.CCOC=O |
| InChI | InChI=1S/C18H30N2O2.C3H6O2/c1-15-9-8-12-20(15)18(22)11-7-5-3-2-4-6-10-16-13-17(16)19-14-21;1-2-5-3-4/h6,10,14-17H,2-5,7-9,11-13H2,1H3,(H,19,21);3H,2H2,1H3/b10-6-;/t15?,16-,17?;/m1./s1 |
| InChIKey | GSCQTWGMVAMROL-QZZFQJARSA-N |
| XLogP | 3.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|