C20H33NO2 — CID 143401233
(Z)-1-[(2S)-2-acetylpyrrolidin-1-yl]-8-[(1R)-2-propylcyclopropyl]oct-7-en-1-one (PubChem CID 143401233) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (Z)-1-[(2S)-2-acetylpyrrolidin-1-yl]-8-[(1R)-2-propylcyclopropyl]oct-7-en-1-one.
| Compound Name | (Z)-1-[(2S)-2-acetylpyrrolidin-1-yl]-8-[(1R)-2-propylcyclopropyl]oct-7-en-1-one |
|---|---|
| PubChem CID | 143401233 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (Z)-1-[(2S)-2-acetylpyrrolidin-1-yl]-8-[(1R)-2-propylcyclopropyl]oct-7-en-1-one |
| SMILES | CCCC1C[C@H]1/C=C\CCCCCC(=O)N1CCC[C@H]1C(C)=O |
| InChI | InChI=1S/C20H33NO2/c1-3-10-17-15-18(17)11-7-5-4-6-8-13-20(23)21-14-9-12-19(21)16(2)22/h7,11,17-19H,3-6,8-10,12-15H2,1-2H3/b11-7-/t17?,18-,19+/m1/s1 |
| InChIKey | IVJXGKQWULWBMK-VWEIZXGESA-N |
| XLogP | 4.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|