C13H24N2O — CID 143818570
(3E,4Z)-1-amino-3,4-di(ethylidene)pyridin-2-one;ethane (PubChem CID 143818570) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (3E,4Z)-1-amino-3,4-di(ethylidene)pyridin-2-one;ethane.
| Compound Name | (3E,4Z)-1-amino-3,4-di(ethylidene)pyridin-2-one;ethane |
|---|---|
| PubChem CID | 143818570 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (3E,4Z)-1-amino-3,4-di(ethylidene)pyridin-2-one;ethane |
| SMILES | C/C=c1/ccn(N)c(=O)/c1=C/C.CC.CC |
| InChI | InChI=1S/C9H12N2O.2C2H6/c1-3-7-5-6-11(10)9(12)8(7)4-2;2*1-2/h3-6H,10H2,1-2H3;2*1-2H3/b7-3-,8-4+;; |
| InChIKey | FQCNJXARISLPLA-IRGDVNFTSA-N |
| XLogP | 1.22 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |