C10H13NO — CID 139296680
(5Z,6E)-5,6-di(ethylidene)-4-methylpyridin-2-one (PubChem CID 139296680) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (5Z,6E)-5,6-di(ethylidene)-4-methylpyridin-2-one.
| Compound Name | (5Z,6E)-5,6-di(ethylidene)-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 139296680 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (5Z,6E)-5,6-di(ethylidene)-4-methylpyridin-2-one |
| SMILES | C/C=c1/c(C)cc(=O)[nH]/c1=C/C |
| InChI | InChI=1S/C10H13NO/c1-4-8-7(3)6-10(12)11-9(8)5-2/h4-6H,1-3H3,(H,11,12)/b8-4-,9-5+ |
| InChIKey | ARYYGNJOBJCXJX-MVTUOISNSA-N |
| XLogP | 0.28 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |