C8H11NO2 — CID 163918634
6-methoxy-4,5-dimethyl-1H-pyridin-2-one (PubChem CID 163918634) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 6-methoxy-4,5-dimethyl-1H-pyridin-2-one.
| Compound Name | 6-methoxy-4,5-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 163918634 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 6-methoxy-4,5-dimethyl-1H-pyridin-2-one |
| SMILES | COc1[nH]c(=O)cc(C)c1C |
| InChI | InChI=1S/C8H11NO2/c1-5-4-7(10)9-8(11-3)6(5)2/h4H,1-3H3,(H,9,10) |
| InChIKey | QYMHEQNHGHIXFB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |