C9H13N — CID 123884571
2,3-di(ethylidene)-5-methyl-1H-pyrrole (PubChem CID 123884571) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 2,3-di(ethylidene)-5-methyl-1H-pyrrole.
| Compound Name | 2,3-di(ethylidene)-5-methyl-1H-pyrrole |
|---|---|
| PubChem CID | 123884571 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2,3-di(ethylidene)-5-methyl-1H-pyrrole |
| SMILES | CC=c1cc(C)[nH]c1=CC |
| InChI | InChI=1S/C9H13N/c1-4-8-6-7(3)10-9(8)5-2/h4-6,10H,1-3H3 |
| InChIKey | ZESNECNSJQGOOV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |