C5H5Cl2N — CID 18918860
2,3-dichloro-5-methyl-1H-pyrrole (PubChem CID 18918860) has the molecular formula C5H5Cl2N and a molecular weight of 150.01 g/mol. Its IUPAC name is 2,3-dichloro-5-methyl-1H-pyrrole.
| Compound Name | 2,3-dichloro-5-methyl-1H-pyrrole |
|---|---|
| PubChem CID | 18918860 |
| Molecular Formula | C5H5Cl2N |
| Molecular Weight | 150.01 g/mol |
| Exact Mass | 148.98 |
| IUPAC Name | 2,3-dichloro-5-methyl-1H-pyrrole |
| SMILES | Cc1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C5H5Cl2N/c1-3-2-4(6)5(7)8-3/h2,8H,1H3 |
| InChIKey | GAEXBUFVNHZLOI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.01 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |