C12H9ClN2 — CID 136921471
9-chloro-7-methyl-6H-pyrrolo[3,2-f]quinoline (PubChem CID 136921471) has the molecular formula C12H9ClN2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 9-chloro-7-methyl-6H-pyrrolo[3,2-f]quinoline.
| Compound Name | 9-chloro-7-methyl-6H-pyrrolo[3,2-f]quinoline |
|---|---|
| PubChem CID | 136921471 |
| Molecular Formula | C12H9ClN2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 9-chloro-7-methyl-6H-pyrrolo[3,2-f]quinoline |
| SMILES | Cc1cc(Cl)c2c(ccc3nccc32)[nH]1 |
| InChI | InChI=1S/C12H9ClN2/c1-7-6-9(13)12-8-4-5-14-10(8)2-3-11(12)15-7/h2-6,15H,1H3 |
| InChIKey | TVHCHDWNYQZRAS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |