About 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol
7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol (PubChem CID 137242115) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol.
Molecular Properties
| Compound Name | 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol |
| PubChem CID | 137242115 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol |
| SMILES | Cc1ccc2c(cc(O)c3nccc32)[nH]1 |
| InChI | InChI=1S/C12H10N2O/c1-7-2-3-8-9-4-5-13-12(9)11(15)6-10(8)14-7/h2-6,14-15H,1H3 |
| InChIKey | VFWJODFELJCQOX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol?
The IUPAC name of 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol (CID 137242115) is 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol.
What is the SMILES notation for 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol?
The canonical SMILES for 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol is Cc1ccc2c(cc(O)c3nccc32)[nH]1.
What is the InChIKey of 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol?
The InChIKey is VFWJODFELJCQOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c1-7-2-3-8-9-4-5-13-12(9)11(15)6-10(8)14-7/h2-6,14-15H,1H3.
What are the key properties of 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol?
7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol has a molecular weight of 198.22 g/mol, XLogP of 2.73, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol is sourced from PubChem (CID 137242115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).