C12H10N2O — CID 137242115
7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol (PubChem CID 137242115) has the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. Its IUPAC name is 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol.
| Compound Name | 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol |
|---|---|
| PubChem CID | 137242115 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 7-methyl-6H-pyrrolo[3,2-f]quinolin-4-ol |
| SMILES | Cc1ccc2c(cc(O)c3nccc32)[nH]1 |
| InChI | InChI=1S/C12H10N2O/c1-7-2-3-8-9-4-5-13-12(9)11(15)6-10(8)14-7/h2-6,14-15H,1H3 |
| InChIKey | VFWJODFELJCQOX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |