C10H8N4 — CID 146681376
4H-pyrrolo[3,2-f]quinazolin-3-amine (PubChem CID 146681376) has the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. Its IUPAC name is 4H-pyrrolo[3,2-f]quinazolin-3-amine.
| Compound Name | 4H-pyrrolo[3,2-f]quinazolin-3-amine |
|---|---|
| PubChem CID | 146681376 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4H-pyrrolo[3,2-f]quinazolin-3-amine |
| SMILES | Nc1ncc2c(ccc3nccc32)[nH]1 |
| InChI | InChI=1S/C10H8N4/c11-10-13-5-7-6-3-4-12-8(6)1-2-9(7)14-10/h1-5H,(H3,11,13,14) |
| InChIKey | GXURQBUINCWZRV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |