C11H7N3 — CID 172654038
pyrrolo[2,3-i][2,4]benzodiazepine (PubChem CID 172654038) has the molecular formula C11H7N3 and a molecular weight of 181.20 g/mol. Its IUPAC name is pyrrolo[2,3-i][2,4]benzodiazepine.
| Compound Name | pyrrolo[2,3-i][2,4]benzodiazepine |
|---|---|
| PubChem CID | 172654038 |
| Molecular Formula | C11H7N3 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | pyrrolo[2,3-i][2,4]benzodiazepine |
| SMILES | c1ncc2ccc3nccc3c2cn1 |
| InChI | InChI=1S/C11H7N3/c1-2-11-9(3-4-14-11)10-6-13-7-12-5-8(1)10/h1-7H |
| InChIKey | TWKVCYMPUADIAN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |