C10H6N2O — CID 140592129
pyrrolo[3,2-f][1,2]benzoxazine (PubChem CID 140592129) has the molecular formula C10H6N2O and a molecular weight of 170.17 g/mol. Its IUPAC name is pyrrolo[3,2-f][1,2]benzoxazine.
| Compound Name | pyrrolo[3,2-f][1,2]benzoxazine |
|---|---|
| PubChem CID | 140592129 |
| Molecular Formula | C10H6N2O |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | pyrrolo[3,2-f][1,2]benzoxazine |
| SMILES | c1cc2c(ccc3nccc32)on1 |
| InChI | InChI=1S/C10H6N2O/c1-2-10-8(4-6-12-13-10)7-3-5-11-9(1)7/h1-6H |
| InChIKey | GZPXPJYXPRAANI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |