About 1-quinolin-6-yloxy-2,6-naphthyridine
1-quinolin-6-yloxy-2,6-naphthyridine (PubChem CID 166359692) has the molecular formula C17H11N3O
and a molecular weight of 273.30 g/mol. Its IUPAC name is 1-quinolin-6-yloxy-2,6-naphthyridine.
Molecular Properties
| Compound Name | 1-quinolin-6-yloxy-2,6-naphthyridine |
| PubChem CID | 166359692 |
| Molecular Formula | C17H11N3O |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 1-quinolin-6-yloxy-2,6-naphthyridine |
| SMILES | c1cnc2ccc(Oc3nccc4cnccc34)cc2c1 |
| InChI | InChI=1S/C17H11N3O/c1-2-12-10-14(3-4-16(12)19-7-1)21-17-15-6-8-18-11-13(15)5-9-20-17/h1-11H |
| InChIKey | KNMBMLZHDMFOLF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-quinolin-6-yloxy-2,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-quinolin-6-yloxy-2,6-naphthyridine?
The IUPAC name of 1-quinolin-6-yloxy-2,6-naphthyridine (CID 166359692) is 1-quinolin-6-yloxy-2,6-naphthyridine.
What is the SMILES notation for 1-quinolin-6-yloxy-2,6-naphthyridine?
The canonical SMILES for 1-quinolin-6-yloxy-2,6-naphthyridine is c1cnc2ccc(Oc3nccc4cnccc34)cc2c1.
What is the InChIKey of 1-quinolin-6-yloxy-2,6-naphthyridine?
The InChIKey is KNMBMLZHDMFOLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N3O/c1-2-12-10-14(3-4-16(12)19-7-1)21-17-15-6-8-18-11-13(15)5-9-20-17/h1-11H.
What are the key properties of 1-quinolin-6-yloxy-2,6-naphthyridine?
1-quinolin-6-yloxy-2,6-naphthyridine has a molecular weight of 273.30 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-quinolin-6-yloxy-2,6-naphthyridine is sourced from PubChem (CID 166359692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).