C14H11Cl2N — CID 156769034
1,8-dichloro-3,6-dimethyl-9H-carbazole (PubChem CID 156769034) has the molecular formula C14H11Cl2N and a molecular weight of 264.16 g/mol. Its IUPAC name is 1,8-dichloro-3,6-dimethyl-9H-carbazole.
| Compound Name | 1,8-dichloro-3,6-dimethyl-9H-carbazole |
|---|---|
| PubChem CID | 156769034 |
| Molecular Formula | C14H11Cl2N |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 1,8-dichloro-3,6-dimethyl-9H-carbazole |
| SMILES | Cc1cc(Cl)c2[nH]c3c(Cl)cc(C)cc3c2c1 |
| InChI | InChI=1S/C14H11Cl2N/c1-7-3-9-10-4-8(2)6-12(16)14(10)17-13(9)11(15)5-7/h3-6,17H,1-2H3 |
| InChIKey | WKBLJOYXHLHXEG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |