C21H32FNO6 — CID 143819335
methyl 2-[1,3-dimethoxypropan-2-yl-[hydroxy-(4-methylcyclohexyl)methyl]amino]-4-fluoro-5-hydroxybenzoate (PubChem CID 143819335) has the molecular formula C21H32FNO6 and a molecular weight of 413.49 g/mol. Its IUPAC name is methyl 2-[1,3-dimethoxypropan-2-yl-[hydroxy-(4-methylcyclohexyl)methyl]amino]-4-fluoro-5-hydroxybenzoate.
| Compound Name | methyl 2-[1,3-dimethoxypropan-2-yl-[hydroxy-(4-methylcyclohexyl)methyl]amino]-4-fluoro-5-hydroxybenzoate |
|---|---|
| PubChem CID | 143819335 |
| Molecular Formula | C21H32FNO6 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | methyl 2-[1,3-dimethoxypropan-2-yl-[hydroxy-(4-methylcyclohexyl)methyl]amino]-4-fluoro-5-hydroxybenzoate |
| SMILES | COCC(COC)N(c1cc(F)c(O)cc1C(=O)OC)C(O)C1CCC(C)CC1 |
| InChI | InChI=1S/C21H32FNO6/c1-13-5-7-14(8-6-13)20(25)23(15(11-27-2)12-28-3)18-10-17(22)19(24)9-16(18)21(26)29-4/h9-10,13-15,20,24-25H,5-8,11-12H2,1-4H3 |
| InChIKey | HFPGPDSOYGUMQY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|