C29H28F6N6O3 — CID 143819875
4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-[2-methyl-3-[8-[3-(methylamino)propylcarbamoylamino]imidazo[1,2-a]pyridin-6-yl]phenyl]benzamide (PubChem CID 143819875) has the molecular formula C29H28F6N6O3 and a molecular weight of 622.57 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-[2-methyl-3-[8-[3-(methylamino)propylcarbamoylamino]imidazo[1,2-a]pyridin-6-yl]phenyl]benzamide.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-[2-methyl-3-[8-[3-(methylamino)propylcarbamoylamino]imidazo[1,2-a]pyridin-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 143819875 |
| Molecular Formula | C29H28F6N6O3 |
| Molecular Weight | 622.57 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-[2-methyl-3-[8-[3-(methylamino)propylcarbamoylamino]imidazo[1,2-a]pyridin-6-yl]phenyl]benzamide |
| SMILES | CNCCCNC(=O)Nc1cc(-c2cccc(NC(=O)c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)c2C)cn2ccnc12 |
| InChI | InChI=1S/C29H28F6N6O3/c1-17-21(19-15-23(24-37-13-14-41(24)16-19)40-26(43)38-12-4-11-36-2)5-3-6-22(17)39-25(42)18-7-9-20(10-8-18)27(44,28(30,31)32)29(33,34)35/h3,5-10,13-16,36,44H,4,11-12H2,1-2H3,(H,39,42)(H2,38,40,43) |
| InChIKey | HXXMBVRDRQOHHE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 119.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|