C25H31FN4O4 — CID 143821859
N-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-[3-(dimethylamino)propoxy]-5-fluorophenyl]-6-methoxy-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 143821859) has the molecular formula C25H31FN4O4 and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-[3-(dimethylamino)propoxy]-5-fluorophenyl]-6-methoxy-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-[3-(dimethylamino)propoxy]-5-fluorophenyl]-6-methoxy-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 143821859 |
| Molecular Formula | C25H31FN4O4 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-[3-(dimethylamino)propoxy]-5-fluorophenyl]-6-methoxy-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | [H]/N=C/C(=C\N)c1cc(OCCCN(C)C)c(NC(=O)C2COc3ccc(OC)cc3C2)cc1F |
| InChI | InChI=1S/C25H31FN4O4/c1-30(2)7-4-8-33-24-11-20(18(13-27)14-28)21(26)12-22(24)29-25(31)17-9-16-10-19(32-3)5-6-23(16)34-15-17/h5-6,10-14,17,27H,4,7-9,15,28H2,1-3H3,(H,29,31)/b18-14+,27-13+ |
| InChIKey | JMRVZMAMXLSLTD-RLMXHAGKSA-N |
| XLogP | 3.30 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|