C20H20N4O — CID 143822032
(Z)-3-[2-(3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]-4-iminobut-2-en-2-amine (PubChem CID 143822032) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is (Z)-3-[2-(3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]-4-iminobut-2-en-2-amine.
| Compound Name | (Z)-3-[2-(3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]-4-iminobut-2-en-2-amine |
|---|---|
| PubChem CID | 143822032 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (Z)-3-[2-(3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]-4-iminobut-2-en-2-amine |
| SMILES | [H]/N=C/C(=C(/C)N)c1ccc2nc(C3COc4ccccc4C3)[nH]c2c1 |
| InChI | InChI=1S/C20H20N4O/c1-12(22)16(10-21)13-6-7-17-18(9-13)24-20(23-17)15-8-14-4-2-3-5-19(14)25-11-15/h2-7,9-10,15,21H,8,11,22H2,1H3,(H,23,24)/b16-12+,21-10+ |
| InChIKey | NUSQJWNIWRCXRQ-BRVRAGQSSA-N |
| XLogP | 3.62 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|