C22H24N4O2 — CID 143822040
(Z)-3-imino-2-[2-(6-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]prop-1-en-1-amine (PubChem CID 143822040) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (Z)-3-imino-2-[2-(6-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]prop-1-en-1-amine.
| Compound Name | (Z)-3-imino-2-[2-(6-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 143822040 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (Z)-3-imino-2-[2-(6-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]prop-1-en-1-amine |
| SMILES | [H]/N=C/C(=C\N)c1ccc2nc(C3COc4ccc(OCCC)cc4C3)[nH]c2c1 |
| InChI | InChI=1S/C22H24N4O2/c1-2-7-27-18-4-6-21-15(9-18)8-16(13-28-21)22-25-19-5-3-14(10-20(19)26-22)17(11-23)12-24/h3-6,9-12,16,23H,2,7-8,13,24H2,1H3,(H,25,26)/b17-12+,23-11+ |
| InChIKey | JEKBTSSQSINEKP-NXSXZRGRSA-N |
| XLogP | 4.02 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|