C25H24N4O3 — CID 167295101
5-[(E)-1-[[3-(1H-benzimidazol-2-yl)-3,4-dihydro-2H-chromen-6-yl]oxy]prop-1-enyl]-6-(methylideneamino)-3,4-dihydro-1H-pyridin-2-one (PubChem CID 167295101) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 5-[(E)-1-[[3-(1H-benzimidazol-2-yl)-3,4-dihydro-2H-chromen-6-yl]oxy]prop-1-enyl]-6-(methylideneamino)-3,4-dihydro-1H-pyridin-2-one.
| Compound Name | 5-[(E)-1-[[3-(1H-benzimidazol-2-yl)-3,4-dihydro-2H-chromen-6-yl]oxy]prop-1-enyl]-6-(methylideneamino)-3,4-dihydro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 167295101 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 5-[(E)-1-[[3-(1H-benzimidazol-2-yl)-3,4-dihydro-2H-chromen-6-yl]oxy]prop-1-enyl]-6-(methylideneamino)-3,4-dihydro-1H-pyridin-2-one |
| SMILES | C=NC1=C(/C(=C\C)Oc2ccc3c(c2)CC(c2nc4ccccc4[nH]2)CO3)CCC(=O)N1 |
| InChI | InChI=1S/C25H24N4O3/c1-3-21(18-9-11-23(30)29-25(18)26-2)32-17-8-10-22-15(13-17)12-16(14-31-22)24-27-19-6-4-5-7-20(19)28-24/h3-8,10,13,16H,2,9,11-12,14H2,1H3,(H,27,28)(H,29,30)/b21-3+ |
| InChIKey | DHPSIHRVBQPHJW-WSVFEZOKSA-N |
| XLogP | 4.39 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|