C12H13NO2 — CID 143822063
(2Z)-1-(4-hydroxyphenyl)-2-(methylamino)penta-2,4-dien-1-one (PubChem CID 143822063) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (2Z)-1-(4-hydroxyphenyl)-2-(methylamino)penta-2,4-dien-1-one.
| Compound Name | (2Z)-1-(4-hydroxyphenyl)-2-(methylamino)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 143822063 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (2Z)-1-(4-hydroxyphenyl)-2-(methylamino)penta-2,4-dien-1-one |
| SMILES | C=C/C=C(\NC)C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H13NO2/c1-3-4-11(13-2)12(15)9-5-7-10(14)8-6-9/h3-8,13-14H,1H2,2H3/b11-4- |
| InChIKey | ZMODHAOPQLOBEH-WCIBSUBMSA-N |
| XLogP | 1.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|