C26H36N2O — CID 143822837
ethane;1-methyl-5-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-4-[2-(4-methylphenyl)ethyl]pyrrolidin-3-one (PubChem CID 143822837) has the molecular formula C26H36N2O and a molecular weight of 392.59 g/mol. Its IUPAC name is ethane;1-methyl-5-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-4-[2-(4-methylphenyl)ethyl]pyrrolidin-3-one.
| Compound Name | ethane;1-methyl-5-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-4-[2-(4-methylphenyl)ethyl]pyrrolidin-3-one |
|---|---|
| PubChem CID | 143822837 |
| Molecular Formula | C26H36N2O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | ethane;1-methyl-5-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-4-[2-(4-methylphenyl)ethyl]pyrrolidin-3-one |
| SMILES | CC.Cc1ccc(CCC2C(=O)CN(C)C2c2ccc3c(c2)CCCN3C)cc1 |
| InChI | InChI=1S/C24H30N2O.C2H6/c1-17-6-8-18(9-7-17)10-12-21-23(27)16-26(3)24(21)20-11-13-22-19(15-20)5-4-14-25(22)2;1-2/h6-9,11,13,15,21,24H,4-5,10,12,14,16H2,1-3H3;1-2H3 |
| InChIKey | VYJPMDMIMRYHIK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|