C16H22N4O — CID 79972360
5-amino-4-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-3-propan-2-yl-4H-imidazol-2-one (PubChem CID 79972360) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-amino-4-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-3-propan-2-yl-4H-imidazol-2-one.
| Compound Name | 5-amino-4-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-3-propan-2-yl-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79972360 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 5-amino-4-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-3-propan-2-yl-4H-imidazol-2-one |
| SMILES | CC(C)N1C(=O)N=C(N)C1c1ccc2c(c1)CCCN2C |
| InChI | InChI=1S/C16H22N4O/c1-10(2)20-14(15(17)18-16(20)21)12-6-7-13-11(9-12)5-4-8-19(13)3/h6-7,9-10,14H,4-5,8H2,1-3H3,(H2,17,18,21) |
| InChIKey | XXGPXTFAHZHURJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|