C29H28BrClFN3O3 — CID 143823481
N-[2-[4-(5-bromo-2-piperidin-4-yloxyphenyl)-2-(3-fluorophenyl)-6-oxopiperidin-3-yl]-5-chlorophenyl]formamide (PubChem CID 143823481) has the molecular formula C29H28BrClFN3O3 and a molecular weight of 600.92 g/mol. Its IUPAC name is N-[2-[4-(5-bromo-2-piperidin-4-yloxyphenyl)-2-(3-fluorophenyl)-6-oxopiperidin-3-yl]-5-chlorophenyl]formamide.
| Compound Name | N-[2-[4-(5-bromo-2-piperidin-4-yloxyphenyl)-2-(3-fluorophenyl)-6-oxopiperidin-3-yl]-5-chlorophenyl]formamide |
|---|---|
| PubChem CID | 143823481 |
| Molecular Formula | C29H28BrClFN3O3 |
| Molecular Weight | 600.92 g/mol |
| Exact Mass | 599.10 |
| IUPAC Name | N-[2-[4-(5-bromo-2-piperidin-4-yloxyphenyl)-2-(3-fluorophenyl)-6-oxopiperidin-3-yl]-5-chlorophenyl]formamide |
| SMILES | O=CNc1cc(Cl)ccc1C1C(c2cc(Br)ccc2OC2CCNCC2)CC(=O)NC1c1cccc(F)c1 |
| InChI | InChI=1S/C29H28BrClFN3O3/c30-18-4-7-26(38-21-8-10-33-11-9-21)23(13-18)24-15-27(37)35-29(17-2-1-3-20(32)12-17)28(24)22-6-5-19(31)14-25(22)34-16-36/h1-7,12-14,16,21,24,28-29,33H,8-11,15H2,(H,34,36)(H,35,37) |
| InChIKey | XYZTWGYKVYESMR-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.92 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|