C17H15Cl2FN2O — CID 143648501
N-[5-chloro-2-[(4S)-4-(3-chlorophenyl)pyrrolidin-3-yl]-4-fluorophenyl]formamide (PubChem CID 143648501) has the molecular formula C17H15Cl2FN2O and a molecular weight of 353.22 g/mol. Its IUPAC name is N-[5-chloro-2-[(4S)-4-(3-chlorophenyl)pyrrolidin-3-yl]-4-fluorophenyl]formamide.
| Compound Name | N-[5-chloro-2-[(4S)-4-(3-chlorophenyl)pyrrolidin-3-yl]-4-fluorophenyl]formamide |
|---|---|
| PubChem CID | 143648501 |
| Molecular Formula | C17H15Cl2FN2O |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | N-[5-chloro-2-[(4S)-4-(3-chlorophenyl)pyrrolidin-3-yl]-4-fluorophenyl]formamide |
| SMILES | O=CNc1cc(Cl)c(F)cc1C1CNC[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2FN2O/c18-11-3-1-2-10(4-11)13-7-21-8-14(13)12-5-16(20)15(19)6-17(12)22-9-23/h1-6,9,13-14,21H,7-8H2,(H,22,23)/t13-,14?/m1/s1 |
| InChIKey | YTJDGIAGJQTVKB-KWCCSABGSA-N |
| XLogP | 4.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|