C28H39Cl2F2N3O3 — CID 143648442
N-[5-chloro-2-[(4S)-4-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-4-fluorophenyl]formamide;2,2-dimethylpropane;N-(5-hydroxypentyl)formamide (PubChem CID 143648442) has the molecular formula C28H39Cl2F2N3O3 and a molecular weight of 574.54 g/mol. Its IUPAC name is N-[5-chloro-2-[(4S)-4-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-4-fluorophenyl]formamide;2,2-dimethylpropane;N-(5-hydroxypentyl)formamide.
| Compound Name | N-[5-chloro-2-[(4S)-4-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-4-fluorophenyl]formamide;2,2-dimethylpropane;N-(5-hydroxypentyl)formamide |
|---|---|
| PubChem CID | 143648442 |
| Molecular Formula | C28H39Cl2F2N3O3 |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | N-[5-chloro-2-[(4S)-4-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-4-fluorophenyl]formamide;2,2-dimethylpropane;N-(5-hydroxypentyl)formamide |
| SMILES | CC(C)(C)C.O=CNCCCCCO.O=CNc1cc(Cl)c(F)cc1C1CNC[C@@H]1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2F2N2O.C6H13NO2.C5H12/c18-13-3-9(1-2-15(13)20)11-6-22-7-12(11)10-4-16(21)14(19)5-17(10)23-8-24;8-5-3-1-2-4-7-6-9;1-5(2,3)4/h1-5,8,11-12,22H,6-7H2,(H,23,24);6,8H,1-5H2,(H,7,9);1-4H3/t11-,12?;;/m1../s1 |
| InChIKey | SZGWXFLHLWSGBL-HLQRPDAISA-N |
| XLogP | 6.26 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|