C27H33Cl2F2N3O5 — CID 89059076
(2R,3S,4R,5R)-4-(4-chloro-5-fluoro-2-formamidophenyl)-3-(3-chloro-4-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-(2-methoxy-2-methylpropyl)pyrrolidine-2-carboxamide (PubChem CID 89059076) has the molecular formula C27H33Cl2F2N3O5 and a molecular weight of 588.48 g/mol. Its IUPAC name is (2R,3S,4R,5R)-4-(4-chloro-5-fluoro-2-formamidophenyl)-3-(3-chloro-4-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-(2-methoxy-2-methylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5R)-4-(4-chloro-5-fluoro-2-formamidophenyl)-3-(3-chloro-4-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-(2-methoxy-2-methylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89059076 |
| Molecular Formula | C27H33Cl2F2N3O5 |
| Molecular Weight | 588.48 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | (2R,3S,4R,5R)-4-(4-chloro-5-fluoro-2-formamidophenyl)-3-(3-chloro-4-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-(2-methoxy-2-methylpropyl)pyrrolidine-2-carboxamide |
| SMILES | COC(C)(C)C[C@H]1N[C@@H](C(=O)NCC[C@H](O)CO)[C@H](c2ccc(F)c(Cl)c2)[C@@H]1c1cc(F)c(Cl)cc1NC=O |
| InChI | InChI=1S/C27H33Cl2F2N3O5/c1-27(2,39-3)11-22-24(16-9-20(31)18(29)10-21(16)33-13-36)23(14-4-5-19(30)17(28)8-14)25(34-22)26(38)32-7-6-15(37)12-35/h4-5,8-10,13,15,22-25,34-35,37H,6-7,11-12H2,1-3H3,(H,32,38)(H,33,36)/t15-,22+,23+,24+,25+/m0/s1 |
| InChIKey | QWDVZENVJOXTNV-PKMPITMTSA-N |
| XLogP | 3.72 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|