C28H34Cl2FN3O3 — CID 118680371
(2R,3S,4R,5R)-3-(5-chloro-2-fluorophenyl)-4-(4-chloro-2-formamidophenyl)-5-(2,2-dimethylpropyl)-N-(3-hydroxy-3-methylcyclobutyl)pyrrolidine-2-carboxamide (PubChem CID 118680371) has the molecular formula C28H34Cl2FN3O3 and a molecular weight of 550.50 g/mol. Its IUPAC name is (2R,3S,4R,5R)-3-(5-chloro-2-fluorophenyl)-4-(4-chloro-2-formamidophenyl)-5-(2,2-dimethylpropyl)-N-(3-hydroxy-3-methylcyclobutyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5R)-3-(5-chloro-2-fluorophenyl)-4-(4-chloro-2-formamidophenyl)-5-(2,2-dimethylpropyl)-N-(3-hydroxy-3-methylcyclobutyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118680371 |
| Molecular Formula | C28H34Cl2FN3O3 |
| Molecular Weight | 550.50 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | (2R,3S,4R,5R)-3-(5-chloro-2-fluorophenyl)-4-(4-chloro-2-formamidophenyl)-5-(2,2-dimethylpropyl)-N-(3-hydroxy-3-methylcyclobutyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)NC2CC(C)(O)C2)[C@H](c2cc(Cl)ccc2F)[C@@H]1c1ccc(Cl)cc1NC=O |
| InChI | InChI=1S/C28H34Cl2FN3O3/c1-27(2,3)13-22-23(18-7-5-16(30)10-21(18)32-14-35)24(19-9-15(29)6-8-20(19)31)25(34-22)26(36)33-17-11-28(4,37)12-17/h5-10,14,17,22-25,34,37H,11-13H2,1-4H3,(H,32,35)(H,33,36)/t17?,22-,23-,24-,25-,28?/m1/s1 |
| InChIKey | RLCCFOLHBMWFAL-IEXSYKLOSA-N |
| XLogP | 5.37 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|