C21H31FN2O — CID 143824001
methyl (E)-2-amino-N-[1-(2-fluorophenyl)ethenyl]-3-methyl-5-propyloct-2-enimidate (PubChem CID 143824001) has the molecular formula C21H31FN2O and a molecular weight of 346.49 g/mol. Its IUPAC name is methyl (E)-2-amino-N-[1-(2-fluorophenyl)ethenyl]-3-methyl-5-propyloct-2-enimidate.
| Compound Name | methyl (E)-2-amino-N-[1-(2-fluorophenyl)ethenyl]-3-methyl-5-propyloct-2-enimidate |
|---|---|
| PubChem CID | 143824001 |
| Molecular Formula | C21H31FN2O |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | methyl (E)-2-amino-N-[1-(2-fluorophenyl)ethenyl]-3-methyl-5-propyloct-2-enimidate |
| SMILES | C=C(/N=C(OC)/C(N)=C(/C)CC(CCC)CCC)c1ccccc1F |
| InChI | InChI=1S/C21H31FN2O/c1-6-10-17(11-7-2)14-15(3)20(23)21(25-5)24-16(4)18-12-8-9-13-19(18)22/h8-9,12-13,17H,4,6-7,10-11,14,23H2,1-3,5H3/b20-15+,24-21- |
| InChIKey | SLXJYBLRCLNUQC-PMZHHLCNSA-N |
| XLogP | 5.68 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|