C17H21F3N2O3 — CID 143825461
N-[cyclohexyl(methyl)carbamoyl]-4-methoxy-2-(trifluoromethyl)benzamide (PubChem CID 143825461) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is N-[cyclohexyl(methyl)carbamoyl]-4-methoxy-2-(trifluoromethyl)benzamide.
| Compound Name | N-[cyclohexyl(methyl)carbamoyl]-4-methoxy-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 143825461 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[cyclohexyl(methyl)carbamoyl]-4-methoxy-2-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(C(=O)NC(=O)N(C)C2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F3N2O3/c1-22(11-6-4-3-5-7-11)16(24)21-15(23)13-9-8-12(25-2)10-14(13)17(18,19)20/h8-11H,3-7H2,1-2H3,(H,21,23,24) |
| InChIKey | OGMMAGDNSDOYER-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |