C21H21F3N6O5 — CID 143826338
4-[[2-(methylamino)-4-oxo-3H-pteridin-6-yl]methyl-(2,2,2-trifluoroacetyl)amino]benzoic acid;2-methylpropanal (PubChem CID 143826338) has the molecular formula C21H21F3N6O5 and a molecular weight of 494.43 g/mol. Its IUPAC name is 4-[[2-(methylamino)-4-oxo-3H-pteridin-6-yl]methyl-(2,2,2-trifluoroacetyl)amino]benzoic acid;2-methylpropanal.
| Compound Name | 4-[[2-(methylamino)-4-oxo-3H-pteridin-6-yl]methyl-(2,2,2-trifluoroacetyl)amino]benzoic acid;2-methylpropanal |
|---|---|
| PubChem CID | 143826338 |
| Molecular Formula | C21H21F3N6O5 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 4-[[2-(methylamino)-4-oxo-3H-pteridin-6-yl]methyl-(2,2,2-trifluoroacetyl)amino]benzoic acid;2-methylpropanal |
| SMILES | CC(C)C=O.CNc1nc2ncc(CN(C(=O)C(F)(F)F)c3ccc(C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H13F3N6O4.C4H8O/c1-21-16-24-12-11(13(27)25-16)23-9(6-22-12)7-26(15(30)17(18,19)20)10-4-2-8(3-5-10)14(28)29;1-4(2)3-5/h2-6H,7H2,1H3,(H,28,29)(H2,21,22,24,25,27);3-4H,1-2H3 |
| InChIKey | RMNOZYPDLFKEDV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 158.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|