C30H36FN5O8S — CID 143826711
[(3R,5S)-5-[[(1R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-1-[4-(prop-2-enoylamino)butanoyl]pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate (PubChem CID 143826711) has the molecular formula C30H36FN5O8S and a molecular weight of 645.71 g/mol. Its IUPAC name is [(3R,5S)-5-[[(1R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-1-[4-(prop-2-enoylamino)butanoyl]pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(3R,5S)-5-[[(1R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-1-[4-(prop-2-enoylamino)butanoyl]pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 143826711 |
| Molecular Formula | C30H36FN5O8S |
| Molecular Weight | 645.71 g/mol |
| Exact Mass | 645.23 |
| IUPAC Name | [(3R,5S)-5-[[(1R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-1-[4-(prop-2-enoylamino)butanoyl]pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
| SMILES | C=CC(=O)NCCCC(=O)N1C[C@H](OC(=O)N2Cc3cccc(F)c3C2)C[C@H]1C(=O)N[C@]1(C(=O)NS(=O)(=O)C2CC2)CC1C=C |
| InChI | InChI=1S/C30H36FN5O8S/c1-3-19-14-30(19,28(40)34-45(42,43)21-10-11-21)33-27(39)24-13-20(16-36(24)26(38)9-6-12-32-25(37)4-2)44-29(41)35-15-18-7-5-8-23(31)22(18)17-35/h3-5,7-8,19-21,24H,1-2,6,9-17H2,(H,32,37)(H,33,39)(H,34,40)/t19?,20-,24+,30-/m1/s1 |
| InChIKey | XHDFUNJHZNKNPJ-OXBLXHCUSA-N |
| XLogP | 1.00 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.71 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|