C27H30FN5O9S — CID 25114752
[(3R,5S)-5-[[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-1-(2-oxo-1,3-oxazolidine-4-carbonyl)pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate (PubChem CID 25114752) has the molecular formula C27H30FN5O9S and a molecular weight of 619.63 g/mol. Its IUPAC name is [(3R,5S)-5-[[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-1-(2-oxo-1,3-oxazolidine-4-carbonyl)pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(3R,5S)-5-[[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-1-(2-oxo-1,3-oxazolidine-4-carbonyl)pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 25114752 |
| Molecular Formula | C27H30FN5O9S |
| Molecular Weight | 619.63 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | [(3R,5S)-5-[[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-1-(2-oxo-1,3-oxazolidine-4-carbonyl)pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](OC(=O)N2Cc3cccc(F)c3C2)CN1C(=O)C1COC(=O)N1)C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C27H30FN5O9S/c1-2-15-9-27(15,24(36)31-43(39,40)17-6-7-17)30-22(34)21-8-16(11-33(21)23(35)20-13-41-25(37)29-20)42-26(38)32-10-14-4-3-5-19(28)18(14)12-32/h2-5,15-17,20-21H,1,6-13H2,(H,29,37)(H,30,34)(H,31,36)/t15-,16-,20?,21+,27-/m1/s1 |
| InChIKey | RXPHKZXZZCCGEO-PLLRYEKMSA-N |
| XLogP | 0.03 |
| TPSA | 180.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.63 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|