C38H59N3O6 — CID 143827188
[3a-[[(2Z)-2-amino-2-ethoxyiminoacetyl]amino]-5b,8,8,11a-tetramethyl-2-oxo-1-propan-2-yl-3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-9-yl] 3,3-dimethyl-4-oxobutanoate (PubChem CID 143827188) has the molecular formula C38H59N3O6 and a molecular weight of 653.91 g/mol. Its IUPAC name is [3a-[[(2Z)-2-amino-2-ethoxyiminoacetyl]amino]-5b,8,8,11a-tetramethyl-2-oxo-1-propan-2-yl-3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-9-yl] 3,3-dimethyl-4-oxobutanoate.
| Compound Name | [3a-[[(2Z)-2-amino-2-ethoxyiminoacetyl]amino]-5b,8,8,11a-tetramethyl-2-oxo-1-propan-2-yl-3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-9-yl] 3,3-dimethyl-4-oxobutanoate |
|---|---|
| PubChem CID | 143827188 |
| Molecular Formula | C38H59N3O6 |
| Molecular Weight | 653.91 g/mol |
| Exact Mass | 653.44 |
| IUPAC Name | [3a-[[(2Z)-2-amino-2-ethoxyiminoacetyl]amino]-5b,8,8,11a-tetramethyl-2-oxo-1-propan-2-yl-3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-9-yl] 3,3-dimethyl-4-oxobutanoate |
| SMILES | CCO/N=C(\N)C(=O)NC12CCC3C(CCC4C3(C)CCC3C(C)(C)C(OC(=O)CC(C)(C)C=O)CCC34C)C1=C(C(C)C)C(=O)C2 |
| InChI | InChI=1S/C38H59N3O6/c1-10-46-41-32(39)33(45)40-38-18-13-24-23(31(38)30(22(2)3)25(43)19-38)11-12-27-36(24,8)16-14-26-35(6,7)28(15-17-37(26,27)9)47-29(44)20-34(4,5)21-42/h21-24,26-28H,10-20H2,1-9H3,(H2,39,41)(H,40,45) |
| InChIKey | QRCVCAGXNWPMQI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.91 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|