C37H59NO7 — CID 143827288
[3a-(methoxycarbonylamino)-5b,8,8,11a-tetramethyl-2-oxo-1-propan-2-yl-3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-9-yl] 3,3-dimethylbutanoate;formic acid (PubChem CID 143827288) has the molecular formula C37H59NO7 and a molecular weight of 629.88 g/mol. Its IUPAC name is [3a-(methoxycarbonylamino)-5b,8,8,11a-tetramethyl-2-oxo-1-propan-2-yl-3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-9-yl] 3,3-dimethylbutanoate;formic acid.
| Compound Name | [3a-(methoxycarbonylamino)-5b,8,8,11a-tetramethyl-2-oxo-1-propan-2-yl-3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-9-yl] 3,3-dimethylbutanoate;formic acid |
|---|---|
| PubChem CID | 143827288 |
| Molecular Formula | C37H59NO7 |
| Molecular Weight | 629.88 g/mol |
| Exact Mass | 629.43 |
| IUPAC Name | [3a-(methoxycarbonylamino)-5b,8,8,11a-tetramethyl-2-oxo-1-propan-2-yl-3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-9-yl] 3,3-dimethylbutanoate;formic acid |
| SMILES | COC(=O)NC12CCC3C(CCC4C3(C)CCC3C(C)(C)C(OC(=O)CC(C)(C)C)CCC34C)C1=C(C(C)C)C(=O)C2.O=CO |
| InChI | InChI=1S/C36H57NO5.CH2O2/c1-21(2)29-24(38)19-36(37-31(40)41-10)18-13-23-22(30(29)36)11-12-26-34(23,8)16-14-25-33(6,7)27(15-17-35(25,26)9)42-28(39)20-32(3,4)5;2-1-3/h21-23,25-27H,11-20H2,1-10H3,(H,37,40);1H,(H,2,3) |
| InChIKey | PXCZEWJCYUFWQT-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.88 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|