C39H59NO5 — CID 143827308
acetaldehyde;formamide;9-methoxy-5b,8,8,11a-tetramethyl-3a-phenylmethoxy-1-propan-2-yl-3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-2-one (PubChem CID 143827308) has the molecular formula C39H59NO5 and a molecular weight of 621.90 g/mol. Its IUPAC name is acetaldehyde;formamide;9-methoxy-5b,8,8,11a-tetramethyl-3a-phenylmethoxy-1-propan-2-yl-3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-2-one.
| Compound Name | acetaldehyde;formamide;9-methoxy-5b,8,8,11a-tetramethyl-3a-phenylmethoxy-1-propan-2-yl-3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-2-one |
|---|---|
| PubChem CID | 143827308 |
| Molecular Formula | C39H59NO5 |
| Molecular Weight | 621.90 g/mol |
| Exact Mass | 621.44 |
| IUPAC Name | acetaldehyde;formamide;9-methoxy-5b,8,8,11a-tetramethyl-3a-phenylmethoxy-1-propan-2-yl-3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-2-one |
| SMILES | CC=O.COC1CCC2(C)C(CCC3(C)C4CCC5(OCc6ccccc6)CC(=O)C(C(C)C)=C5C4CCC32)C1(C)C.NC=O |
| InChI | InChI=1S/C36H52O3.C2H4O.CH3NO/c1-23(2)31-27(37)21-36(39-22-24-11-9-8-10-12-24)20-15-26-25(32(31)36)13-14-29-34(26,5)18-16-28-33(3,4)30(38-7)17-19-35(28,29)6;1-2-3;2-1-3/h8-12,23,25-26,28-30H,13-22H2,1-7H3;2H,1H3;1H,(H2,2,3) |
| InChIKey | ZVSRFYUGIRCHAC-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.90 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|