C27H37NO2 — CID 143827954
3',7'-dimethyl-14'-pyrrolidin-1-ylspiro[oxolane-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-14,16-diene]-2-one (PubChem CID 143827954) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 3',7'-dimethyl-14'-pyrrolidin-1-ylspiro[oxolane-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-14,16-diene]-2-one.
| Compound Name | 3',7'-dimethyl-14'-pyrrolidin-1-ylspiro[oxolane-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-14,16-diene]-2-one |
|---|---|
| PubChem CID | 143827954 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 3',7'-dimethyl-14'-pyrrolidin-1-ylspiro[oxolane-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-14,16-diene]-2-one |
| SMILES | CC12CC1C1(CCC(=O)O1)C1(C)CCC3C4CCC(N5CCCC5)=CC4=CCC3C21 |
| InChI | InChI=1S/C27H37NO2/c1-25-16-22(25)27(12-10-23(29)30-27)26(2)11-9-20-19-8-6-18(28-13-3-4-14-28)15-17(19)5-7-21(20)24(25)26/h5,15,19-22,24H,3-4,6-14,16H2,1-2H3 |
| InChIKey | WNSDYYCXELSDBU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |