C27H31ClNO3- — CID 143828405
N-(6-chlorospiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl)-3-(2-cyclopentyloxy-3-methylphenyl)propanimidate (PubChem CID 143828405) has the molecular formula C27H31ClNO3- and a molecular weight of 453.00 g/mol. Its IUPAC name is N-(6-chlorospiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl)-3-(2-cyclopentyloxy-3-methylphenyl)propanimidate.
| Compound Name | N-(6-chlorospiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl)-3-(2-cyclopentyloxy-3-methylphenyl)propanimidate |
|---|---|
| PubChem CID | 143828405 |
| Molecular Formula | C27H31ClNO3- |
| Molecular Weight | 453.00 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | N-(6-chlorospiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl)-3-(2-cyclopentyloxy-3-methylphenyl)propanimidate |
| SMILES | Cc1cccc(CC/C([O-])=N/C2CC3(CCC3)Oc3ccc(Cl)cc32)c1OC1CCCC1 |
| InChI | InChI=1S/C27H32ClNO3/c1-18-6-4-7-19(26(18)31-21-8-2-3-9-21)10-13-25(30)29-23-17-27(14-5-15-27)32-24-12-11-20(28)16-22(23)24/h4,6-7,11-12,16,21,23H,2-3,5,8-10,13-15,17H2,1H3,(H,29,30)/p-1 |
| InChIKey | XYBZKQHMGIIFAF-UHFFFAOYSA-M |
| XLogP | 6.11 |
| TPSA | 53.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.00 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|