C22H39N3O — CID 143829482
5-[1-(2-cyanoethoxy)-2-methylpropan-2-yl]-6,6-dimethylundecanedinitrile;ethane (PubChem CID 143829482) has the molecular formula C22H39N3O and a molecular weight of 361.57 g/mol. Its IUPAC name is 5-[1-(2-cyanoethoxy)-2-methylpropan-2-yl]-6,6-dimethylundecanedinitrile;ethane.
| Compound Name | 5-[1-(2-cyanoethoxy)-2-methylpropan-2-yl]-6,6-dimethylundecanedinitrile;ethane |
|---|---|
| PubChem CID | 143829482 |
| Molecular Formula | C22H39N3O |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.31 |
| IUPAC Name | 5-[1-(2-cyanoethoxy)-2-methylpropan-2-yl]-6,6-dimethylundecanedinitrile;ethane |
| SMILES | CC.CC(C)(CCCCC#N)C(CCCC#N)C(C)(C)COCCC#N |
| InChI | InChI=1S/C20H33N3O.C2H6/c1-19(2,12-7-5-8-13-21)18(11-6-9-14-22)20(3,4)17-24-16-10-15-23;1-2/h18H,5-12,16-17H2,1-4H3;1-2H3 |
| InChIKey | BMHUNCNSCDGHGI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 80.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|