C16H26N3O3P — CID 175823528
3-[2,3-bis(2-cyanoethoxy)-2-diethylphosphanylpropoxy]propanenitrile (PubChem CID 175823528) has the molecular formula C16H26N3O3P and a molecular weight of 339.38 g/mol. Its IUPAC name is 3-[2,3-bis(2-cyanoethoxy)-2-diethylphosphanylpropoxy]propanenitrile.
| Compound Name | 3-[2,3-bis(2-cyanoethoxy)-2-diethylphosphanylpropoxy]propanenitrile |
|---|---|
| PubChem CID | 175823528 |
| Molecular Formula | C16H26N3O3P |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 3-[2,3-bis(2-cyanoethoxy)-2-diethylphosphanylpropoxy]propanenitrile |
| SMILES | CCP(CC)C(COCCC#N)(COCCC#N)OCCC#N |
| InChI | InChI=1S/C16H26N3O3P/c1-3-23(4-2)16(22-13-7-10-19,14-20-11-5-8-17)15-21-12-6-9-18/h3-7,11-15H2,1-2H3 |
| InChIKey | QBFZCIBUOFZQHH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 99.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|