C33H41N5O3S — CID 143830898
3-cyclohexyl-15-(dimethylaminosulfanylcarbamoyl)-16-[[ethyl(methyl)amino]methyl]-10,14-diazapentacyclo[12.6.1.02,10.04,9.017,21]henicosa-1(20),2,4(9),5,7,15,17(21),18-octaene-7-carboxylic acid (PubChem CID 143830898) has the molecular formula C33H41N5O3S and a molecular weight of 587.79 g/mol. Its IUPAC name is 3-cyclohexyl-15-(dimethylaminosulfanylcarbamoyl)-16-[[ethyl(methyl)amino]methyl]-10,14-diazapentacyclo[12.6.1.02,10.04,9.017,21]henicosa-1(20),2,4(9),5,7,15,17(21),18-octaene-7-carboxylic acid.
| Compound Name | 3-cyclohexyl-15-(dimethylaminosulfanylcarbamoyl)-16-[[ethyl(methyl)amino]methyl]-10,14-diazapentacyclo[12.6.1.02,10.04,9.017,21]henicosa-1(20),2,4(9),5,7,15,17(21),18-octaene-7-carboxylic acid |
|---|---|
| PubChem CID | 143830898 |
| Molecular Formula | C33H41N5O3S |
| Molecular Weight | 587.79 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | 3-cyclohexyl-15-(dimethylaminosulfanylcarbamoyl)-16-[[ethyl(methyl)amino]methyl]-10,14-diazapentacyclo[12.6.1.02,10.04,9.017,21]henicosa-1(20),2,4(9),5,7,15,17(21),18-octaene-7-carboxylic acid |
| SMILES | CCN(C)Cc1c(C(=O)NSN(C)C)n2c3c(cccc13)-c1c(C3CCCCC3)c3ccc(C(=O)O)cc3n1CCC2 |
| InChI | InChI=1S/C33H41N5O3S/c1-5-36(4)20-26-23-13-9-14-25-29(23)38(31(26)32(39)34-42-35(2)3)18-10-17-37-27-19-22(33(40)41)15-16-24(27)28(30(25)37)21-11-7-6-8-12-21/h9,13-16,19,21H,5-8,10-12,17-18,20H2,1-4H3,(H,34,39)(H,40,41) |
| InChIKey | HCHPQBPWBJZZHG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.79 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|