About 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide
2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide (PubChem CID 143831028) has the molecular formula C17H24ClNO2
and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide.
Molecular Properties
| Compound Name | 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide |
| PubChem CID | 143831028 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide |
| SMILES | CCCc1ccc(C)c(/C(C)=C(\C)C(N)=O)c1.O=CCCl |
| InChI | InChI=1S/C15H21NO.C2H3ClO/c1-5-6-13-8-7-10(2)14(9-13)11(3)12(4)15(16)17;3-1-2-4/h7-9H,5-6H2,1-4H3,(H2,16,17);2H,1H2/b12-11+; |
| InChIKey | ILZKUYWQLGILBK-CALJPSDSSA-N |
| XLogP | 3.65 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide?
The IUPAC name of 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide (CID 143831028) is 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide.
What is the SMILES notation for 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide?
The canonical SMILES for 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide is CCCc1ccc(C)c(/C(C)=C(\C)C(N)=O)c1.O=CCCl.
What is the InChIKey of 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide?
The InChIKey is ILZKUYWQLGILBK-CALJPSDSSA-N. The full InChI is InChI=1S/C15H21NO.C2H3ClO/c1-5-6-13-8-7-10(2)14(9-13)11(3)12(4)15(16)17;3-1-2-4/h7-9H,5-6H2,1-4H3,(H2,16,17);2H,1H2/b12-11+;.
What are the key properties of 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide?
2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide has a molecular weight of 309.84 g/mol, XLogP of 3.65, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroacetaldehyde;(E)-2-methyl-3-(2-methyl-5-propylphenyl)but-2-enamide is sourced from PubChem (CID 143831028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).