C27H29ClN4O3S — CID 143831213
N-(4-chloro-3-pyridin-2-ylphenyl)-4-[2-[[[(E)-3-methylpent-2-en-2-yl]amino]methylideneamino]ethylsulfonyl]benzamide (PubChem CID 143831213) has the molecular formula C27H29ClN4O3S and a molecular weight of 525.07 g/mol. Its IUPAC name is N-(4-chloro-3-pyridin-2-ylphenyl)-4-[2-[[[(E)-3-methylpent-2-en-2-yl]amino]methylideneamino]ethylsulfonyl]benzamide.
| Compound Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-[2-[[[(E)-3-methylpent-2-en-2-yl]amino]methylideneamino]ethylsulfonyl]benzamide |
|---|---|
| PubChem CID | 143831213 |
| Molecular Formula | C27H29ClN4O3S |
| Molecular Weight | 525.07 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-[2-[[[(E)-3-methylpent-2-en-2-yl]amino]methylideneamino]ethylsulfonyl]benzamide |
| SMILES | CC/C(C)=C(\C)N/C=N/CCS(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)c(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C27H29ClN4O3S/c1-4-19(2)20(3)31-18-29-15-16-36(34,35)23-11-8-21(9-12-23)27(33)32-22-10-13-25(28)24(17-22)26-7-5-6-14-30-26/h5-14,17-18H,4,15-16H2,1-3H3,(H,29,31)(H,32,33)/b20-19+ |
| InChIKey | LDSHXGVYMHXWPK-FMQUCBEESA-N |
| XLogP | 5.75 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.07 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|